CymitQuimica logo

CAS 82211-92-5

:

4-(2-chlorophenyl)piperidine hydrochloride (1:1)

Description:
4-(2-Chlorophenyl)piperidine hydrochloride, with the CAS number 82211-92-5, is a chemical compound characterized by its piperidine core substituted with a 2-chlorophenyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is indicative of its polar nature due to the presence of the hydrochloride salt form. It is often used in pharmaceutical research and development, particularly in the synthesis of potential therapeutic agents. The presence of the chlorophenyl group can influence its biological activity, making it a subject of interest in medicinal chemistry. Additionally, the hydrochloride salt form enhances its stability and solubility, facilitating its use in various applications. As with many chemical substances, handling should be done with care, adhering to safety protocols to mitigate any potential hazards associated with its use.
Formula:C11H15Cl2N
InChI:InChI=1/C11H14ClN.ClH/c12-11-4-2-1-3-10(11)9-5-7-13-8-6-9;/h1-4,9,13H,5-8H2;1H
InChI key:BALIJVUSWGOXBJ-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)C1CCNCC1)Cl.Cl
Synonyms:
  • Piperidine, 4-(2-Chlorophenyl)-, Hydrochloride (1:1)
  • 4-(2-Chlorophenyl)piperidine hydrochloride (1:1)
Found 3 products.