
CAS 82219-81-6
:5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-8-oxo-3-[(1,2,3-thiadiazol-5-ylthio)methyl]-, sodium salt (1:1), (6R,7R)-
Description:
5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, sodium salt (CAS 82219-81-6), is a complex chemical compound characterized by its bicyclic structure, which incorporates both sulfur and nitrogen atoms. This compound features a thiazole moiety, indicating potential biological activity, particularly in antimicrobial or antifungal applications. The presence of a methoxyimino group suggests it may interact with biological targets through specific binding mechanisms. The sodium salt form enhances its solubility in aqueous environments, making it suitable for pharmaceutical formulations. The stereochemistry, denoted as (6R,7R), indicates specific spatial arrangements of atoms that can influence the compound's biological activity and pharmacokinetics. Overall, this compound's unique structural features and functional groups contribute to its potential utility in medicinal chemistry, particularly in the development of novel therapeutic agents.
Formula:C16H15N7O5S4·Na
InChI:InChI=1S/C16H15N7O5S4.Na/c1-28-21-9(7-5-31-16(17)19-7)12(24)20-10-13(25)23-11(15(26)27)6(4-30-14(10)23)3-29-8-2-18-22-32-8;/h2,5,10,14H,3-4H2,1H3,(H2,17,19)(H,20,24)(H,26,27);/b21-9-;/t10-,14-;/m1./s1
InChI key:InChIKey=CGBUNMLHMSFJHU-IXLPVNPSSA-N
SMILES:C(O)(=O)C=1N2[C@@]([C@H](NC(/C(=N\OC)/C3=CSC(N)=N3)=O)C2=O)(SCC1CSC4=CN=NS4)[H].[Na]
Synonyms:- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-8-oxo-3-[(1,2,3-thiadiazol-5-ylthio)methyl]-, sodium salt (1:1), (6R,7R)-
- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2-amino-4-thiazolyl)(methoxyimino)acetyl]amino]-8-oxo-3-[(1,2,3-thiadiazol-5-ylthio)methyl]-, monosodium salt, [6R-[6α,7β(Z)]]-
- Cefuzonam sodium
- 1,2,3-Thiadiazole, 5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cefuzonam sodium
CAS:Cefuzonam sodium: second-gen cephalosporin, effective against Staph aureus where third-gen fails.Formula:C16H15N7NaO5S4Color and Shape:SolidMolecular weight:536.57
