CAS 82222-85-3
:5-(6-amino-9H-purin-9-yl)pentanenitrile
Description:
5-(6-amino-9H-purin-9-yl)pentanenitrile, with the CAS number 82222-85-3, is a chemical compound that features a purine base structure, which is a key component in nucleic acids. This compound contains an amino group and a pentanenitrile side chain, contributing to its unique properties. The presence of the amino group suggests potential for hydrogen bonding and reactivity, while the nitrile group may impart polar characteristics and influence solubility in various solvents. The purine moiety is known for its role in biological systems, particularly in the formation of nucleotides and nucleic acids, making this compound of interest in biochemical research. Its structural features may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting purine metabolism or related pathways. Overall, the compound's characteristics, including its molecular structure, functional groups, and potential biological activity, make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C10H12N6
InChI:InChI=1/C10H12N6/c11-4-2-1-3-5-16-7-15-8-9(12)13-6-14-10(8)16/h6-7H,1-3,5H2,(H2,12,13,14)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.