CAS 82225-36-3

4-Fluoro-N-2-propyn-1-ylbenzamide

Description:

4-Fluoro-N-2-propyn-1-ylbenzamide is an organic compound characterized by its unique structure, which includes a benzamide moiety substituted with a fluorine atom and a propynyl group. The presence of the fluorine atom enhances the compound's lipophilicity and can influence its reactivity and biological activity. The propynyl group contributes to the compound's overall stability and may affect its interaction with biological targets. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of potential drug candidates. Its molecular structure allows for various functional modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound's properties, such as solubility and melting point, can vary based on the specific conditions and solvents used. As with many fluorinated compounds, 4-Fluoro-N-2-propyn-1-ylbenzamide may exhibit unique pharmacokinetic and pharmacodynamic properties, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated organic compounds.

Formula: C₁₀H₈FNO

InChI: InChI=1S/C10H8FNO/c1-2-7-12-10(13)8-3-5-9(11)6-4-8/h1,3-6H,7H2,(H,12,13)

InChI key: InChIKey=NXBDZSMRZFFVBA-UHFFFAOYSA-N

SMILES: C(NCC#C)(=O)C1=CC=C(F)C=C1

Synonyms:

• Benzamide, 4-fluoro-N-2-propynyl-
• N-Propargyl-4-fluorobenzamide
• Benzamide, 4-fluoro-N-2-propyn-1-yl-
• 4-Fluoro-N-2-propyn-1-ylbenzamide