
CAS 82226-44-6
:5-Hydrazinyl-3(2H)-pyridazinone
Description:
5-Hydrazinyl-3(2H)-pyridazinone, with the CAS number 82226-44-6, is a heterocyclic organic compound characterized by its pyridazinone structure, which features a hydrazine functional group. This compound typically exhibits properties associated with both hydrazines and pyridazinones, including potential reactivity due to the presence of the hydrazine moiety, which can participate in various chemical reactions such as condensation and oxidation. The pyridazinone ring contributes to its stability and may influence its solubility and interaction with biological systems. This compound may be of interest in medicinal chemistry for its potential pharmacological activities, as derivatives of hydrazinyl and pyridazinone structures have been explored for their therapeutic properties. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may serve as an intermediate in the synthesis of more complex molecules. Safety data should be consulted, as compounds containing hydrazine can be hazardous. Overall, 5-Hydrazinyl-3(2H)-pyridazinone represents a versatile scaffold in organic synthesis and medicinal chemistry.
Formula:C4H6N4O
InChI:InChI=1S/C4H6N4O/c5-7-3-1-4(9)8-6-2-3/h1-2H,5H2,(H2,7,8,9)
InChI key:InChIKey=WYZPBDDZXIZOJY-UHFFFAOYSA-N
SMILES:N(N)C1=CC(=O)NN=C1
Synonyms:- 3(2H)-Pyridazinone, 5-hydrazinyl-
- 5-Hydrazinyl-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 5-hydrazino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.