CAS 82227-39-2
:Pibaxizine
Description:
Pibaxizine, with the CAS number 82227-39-2, is a chemical compound that belongs to the class of piperazine derivatives. It is primarily recognized for its potential pharmacological applications, particularly in the field of psychiatry and neurology. The compound exhibits properties that may influence neurotransmitter systems, making it of interest in the development of treatments for various mental health disorders. Pibaxizine is characterized by its specific molecular structure, which includes a piperazine ring, contributing to its biological activity. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many pharmaceuticals, understanding its pharmacokinetics, including absorption, distribution, metabolism, and excretion, is crucial for evaluating its therapeutic potential and safety profile. Research into Pibaxizine continues to explore its efficacy and mechanisms of action, contributing to the broader understanding of piperazine-based compounds in medicinal chemistry.
Formula:C24H29NO4
InChI:InChI=1/C24H29NO4/c26-23(27)19-29-18-17-28-16-15-25-13-11-22(12-14-25)24(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-10H,11-19H2,(H,26,27)
Synonyms:- (2-{2-[4-(diphenylmethylidene)piperidin-1-yl]ethoxy}ethoxy)acetic acid
- UNII-224TL37A39
- (2-(2-(4-(Diphenylmethylene)piperidino)ethoxy)ethoxy)acetic acid
- Pibaxizine [INN]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pibaxizine
CAS:Pibaxizine is diphenylmethyl piperazine derivatives. It is a histamine H1 receptor antagonist.Formula:C24H29NO4Color and Shape:SolidMolecular weight:395.49
