CAS 82228-09-9
:methyl 4,6-O-(phenylmethylidene)-2-O-prop-2-en-1-ylhexopyranoside
Description:
Methyl 4,6-O-(phenylmethylidene)-2-O-prop-2-en-1-ylhexopyranoside, with the CAS number 82228-09-9, is a glycoside derivative characterized by its complex structure, which includes a hexopyranoside backbone modified with various functional groups. This compound features a methyl group, a phenylmethylidene moiety, and an allyl group, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the phenylmethylidene group suggests that it may exhibit interesting optical properties and could participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions. Additionally, the glycosidic nature of the compound indicates that it may have biological relevance, potentially acting as a substrate or inhibitor in enzymatic processes. Its solubility and stability in different solvents can vary, influencing its practical applications. Overall, this compound represents a fascinating example of modified sugars with potential utility in research and industry.
Formula:C17H22O6
InChI:InChI=1/C17H22O6/c1-3-9-20-15-13(18)14-12(22-17(15)19-2)10-21-16(23-14)11-7-5-4-6-8-11/h3-8,12-18H,1,9-10H2,2H3
SMILES:C=CCOC1C(C2C(COC(c3ccccc3)O2)OC1OC)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 2-O-Allyl-4,6-O-benzylidene-alpha-D-mannopyranoside
CAS:Controlled ProductApplications Methyl 2-O-Allyl-4,6-O-benzylidene-α-D-mannopyranoside (cas# 82228-09-9) is a compound useful in organic synthesis.
References Carb. Res., 103, 15 (1982)Formula:C17H22O6Color and Shape:NeatMolecular weight:322.35Methyl 2-O-allyl-4,6-O-benzylidene-a-D-mannopyranoside
CAS:Methyl 2-O-allyl-4,6-O-benzylidene-a-D-mannopyranoside is a complex carbohydrate that has been synthesized from mannose and allyl bromide. This compound is a monosaccharide with a linear structure that contains an allyl group at C2 and a benzylidene group at C4. Methyl 2-O-allyl-4,6-O-benzylidene-a-D-mannopyranoside has been modified by fluorination and saccharification. It can be used in the synthesis of oligosaccharides or as a custom synthesis for monosaccharides. Methyl 2-O-allyl-4,6-O--benzylidene--a--D--mannopyranoside is available in high purity and is made to order.Formula:C17H22O6Purity:Min. 95%Molecular weight:322.35 g/mol


