CAS 82230-93-1

6-{[4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-14-ethyl-7,12,13-trihydroxy-4-[(5-hydroxy-4-methoxy-4,6-dimethyltetrahydro-2H-pyran-2-yl)oxy]-3-(hydroxymethyl)-5,7,9,11,13-pentamethyloxacyclotetradecane-2,10-dione (non-preferred name

Description:

The chemical substance with the name "6-{[4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-14-ethyl-7,12,13-trihydroxy-4-[(5-hydroxy-4-methoxy-4,6-dimethyltetrahydro-2H-pyran-2-yl)oxy]-3-(hydroxymethyl)-5,7,9,11,13-pentamethyloxacyclotetradecane-2,10-dione" and CAS number "82230-93-1" is a complex organic compound characterized by its intricate molecular structure, which includes multiple hydroxyl groups, methoxy groups, and a dimethylamino moiety. This compound features a unique oxacyclotetradecane backbone, indicating a cyclic ether structure that contributes to its stability and potential biological activity. The presence of various substituents, such as hydroxy and methoxy groups, suggests that it may exhibit significant solubility in polar solvents and could interact with biological systems, possibly influencing pharmacological properties. Its structural complexity may also indicate potential applications in medicinal chemistry or as a synthetic intermediate in organic synthesis. However, specific details regarding its reactivity, stability, and biological effects would require further investigation through experimental studies.

Formula: C₃₇H₆₇NO₁₄

InChI: InChI=1/C37H67NO14/c1-13-25-37(9,46)30(42)20(4)27(40)18(2)15-35(7,45)32(52-34-28(41)24(38(10)11)14-19(3)48-34)21(5)29(23(17-39)33(44)50-25)51-26-16-36(8,47-12)31(43)22(6)49-26/h18-26,28-32,34,39,41-43,45-46H,13-17H2,1-12H3

SMILES: CCC1C(C)(C(C(C)C(=O)C(C)CC(C)(C(C(C)C(C(CO)C(=O)O1)OC1CC(C)(C(C(C)O1)O)OC)OC1C(C(CC(C)O1)N(C)C)O)O)O)O

Erythromycin EP Impurity A

CAS: 82230-93-1

Formula: C₃₇H₆₇NO₁₄

Molecular weight: 749.94

Ref: 4Z-E-2013

Erythromycin EP Impurity A

CAS: 82230-93-1

Formula: C₃₇H₆₇NO₁₄

Molecular weight: 749.93

Ref: ST-EA-CP-E18001

Erythromycin F

CAS: 82230-93-1

Erythromycin F is an antibiotic, which is a naturally derived product obtained from the bacterium *Streptomyces erythreus*. It operates by inhibiting bacterial protein synthesis through binding to the 50S ribosomal subunit. This binding effectively blocks the translocation steps in protein elongation, thus preventing the growth and multiplication of susceptible bacteria.

Formula: C₃₇H₆₇NO₁₄

Purity: Min. 95%

Molecular weight: 749.93 g/mol

Ref: 3D-AE31114