CAS 82231-53-6

(4-bromo-1H-pyrazol-1-yl)acetic acid

Description:

(4-bromo-1H-pyrazol-1-yl)acetic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. The acetic acid functional group (-COOH) attached to the nitrogen of the pyrazole enhances its acidity and solubility in polar solvents. This compound is often utilized in medicinal chemistry and organic synthesis due to its ability to act as a building block for more complex molecules. Its properties include moderate stability under standard conditions, and it may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, the compound's molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₅H₅BrN₂O₂

InChI: InChI=1/C5H5BrN2O2/c6-4-1-7-8(2-4)3-5(9)10/h1-2H,3H2,(H,9,10)

SMILES: c1c(cn(CC(=O)O)n1)Br

Synonyms:

• 1H-pyrazole-1-acetic acid, 4-bromo-

AKOS B018507

CAS: 82231-53-6

Formula: C₅H₅BrN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.0094

Ref: IN-DA0056F9

2-(4-Bromo-1H-pyrazol-1-yl)acetic acid

CAS: 82231-53-6

2-(4-Bromo-1H-pyrazol-1-yl)acetic acid

Purity: 98%

Molecular weight: 205.01g/mol

Ref: 54-OR80606

(4-bromo-1H-pyrazol-1-yl)acetic acid

CAS: 82231-53-6

Formula: C₅H₅BrN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 205.011

Ref: 10-F311477

(4-Bromo-1h-pyrazol-1-yl)acetic acid

Controlled Product

CAS: 82231-53-6

Applications (4-Bromo-1h-pyrazol-1-yl)acetic acid

Formula: C₅H₅BrN₂O₂

Color and Shape: Neat

Molecular weight: 205.01

Ref: TR-B698813