CAS 82257-15-6
:4-Methoxy-3-pyridinecarboxaldehyde
Description:
4-Methoxy-3-pyridinecarboxaldehyde, with the CAS number 82257-15-6, is an organic compound characterized by its pyridine ring structure substituted with a methoxy group and an aldehyde functional group. This compound typically appears as a pale yellow to light brown liquid or solid, depending on its purity and form. It is known for its aromatic properties, which can contribute to its use in various chemical syntheses and applications in pharmaceuticals and agrochemicals. The presence of the methoxy group enhances its solubility in organic solvents, while the aldehyde group makes it reactive, allowing for further chemical modifications. Additionally, 4-Methoxy-3-pyridinecarboxaldehyde may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis often involves the functionalization of pyridine derivatives, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H7NO2
InChI:InChI=1/C7H7NO2/c1-10-7-2-3-8-4-6(7)5-9/h2-5H,1H3
SMILES:COc1ccncc1C=O
Synonyms:- 3-Formyl-4-methoxypyridine
- 4-Methoxypyridine-3-Carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Formyl-4-methoxypyridine
CAS:3-Formyl-4-methoxypyridine is a synthetic compound that belongs to the group of pyrimidine ring compounds. It is synthesized by the reaction of triflic acid with 2,6-dichloropyridine and has been shown to have antiviral and antitumour properties. The compound has also been synthetized as a potential drug for the treatment of malaria. 3-Formyl-4-methoxypyridine is an analog of variolin, which is an alkaloid that can be found in marine organisms such as sponges and tunicates. 3-Formyl-4-methoxypyridine has been shown to inhibit protein synthesis by inhibiting the enzyme RNA polymerase II, which leads to cell death by apoptosis or necrosis.Formula:C7H7NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:137.14 g/mol4-Methoxy-3-pyridinecarboxaldehyde
CAS:Formula:C7H7NO2Purity:95%Color and Shape:SolidMolecular weight:137.138


