CAS 82258-37-5

Ethyl 8-(4-chlorophenoxy)-2-methyleneoctanoate

Description:

Ethyl 8-(4-chlorophenoxy)-2-methyleneoctanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol and a carboxylic acid. This compound features a long carbon chain, specifically an octanoate backbone, which contributes to its hydrophobic properties. The presence of the 4-chlorophenoxy group introduces a chlorinated aromatic moiety, enhancing its potential for biological activity and interactions with various receptors. The methylene group adjacent to the ester linkage adds to the compound's structural complexity, potentially influencing its reactivity and solubility. Ethyl 8-(4-chlorophenoxy)-2-methyleneoctanoate may exhibit applications in fields such as pharmaceuticals, agrochemicals, or as a chemical intermediate due to its unique structural features. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₂₃ClO₃

InChI: InChI=1S/C17H23ClO3/c1-3-20-17(19)14(2)8-6-4-5-7-13-21-16-11-9-15(18)10-12-16/h9-12H,2-8,13H2,1H3

InChI key: InChIKey=AWSKXSWREKTACL-UHFFFAOYSA-N

SMILES: O(CCCCCCC(C(OCC)=O)=C)C1=CC=C(Cl)C=C1

Synonyms:

• Ethyl 8-(4-chlorophenoxy)-2-methyleneoctanoate
• Octanoic acid, 8-(4-chlorophenoxy)-2-methylene-, ethyl ester