CAS 82278-28-2

2-phenoxy-N-(2-{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}ethyl)acetamide methanesulfonate (1:1)

Description:

2-Phenoxy-N-(2-{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}ethyl)acetamide methanesulfonate (1:1), with CAS number 82278-28-2, is a chemical compound characterized by its complex structure, which includes a phenoxy group, a piperazine moiety, and a trifluoromethyl-substituted phenyl group. This compound is typically classified as a pharmaceutical agent, often investigated for its potential therapeutic applications, particularly in the field of psychiatry or neurology due to its piperazine component, which is common in many psychoactive drugs. The presence of the methanesulfonate salt form suggests enhanced solubility and stability in biological systems. Its molecular structure indicates potential interactions with various biological targets, making it a subject of interest in drug development. The trifluoromethyl group may contribute to its lipophilicity, influencing its pharmacokinetic properties. Overall, this compound exemplifies the intricate design often found in medicinal chemistry, where specific functional groups are tailored to optimize efficacy and minimize side effects.

Formula: C₂₂H₂₈F₃N₃O₅S

InChI: InChI=1/C21H24F3N3O2.CH4O3S/c22-21(23,24)17-5-4-6-18(15-17)27-13-11-26(12-14-27)10-9-25-20(28)16-29-19-7-2-1-3-8-19;1-5(2,3)4/h1-8,15H,9-14,16H2,(H,25,28);1H3,(H,2,3,4)

SMILES: c1ccc(cc1)OCC(=NCCN1CCN(CC1)c1cccc(c1)C(F)(F)F)O.CS(=O)(=O)O