CAS 82278-73-7

(S)-N-BOC-3-Bromophenylalanine

Description:

(S)-N-BOC-3-Bromophenylalanine is a derivative of the amino acid phenylalanine, characterized by the presence of a bromine atom at the 3-position of the phenyl ring and a tert-butyloxycarbonyl (BOC) protecting group on the amino group. This compound is typically used in peptide synthesis and medicinal chemistry due to its ability to serve as a building block for more complex molecules. The BOC group provides stability and protects the amino group during synthetic procedures, allowing for selective reactions. The bromine substituent can facilitate further functionalization or serve as a leaving group in nucleophilic substitution reactions. (S)-N-BOC-3-Bromophenylalanine is generally a white to off-white solid and is soluble in organic solvents like dichloromethane and dimethyl sulfoxide. Its chirality, indicated by the (S) designation, is crucial for biological activity, as the stereochemistry can significantly influence the compound's interactions with biological targets. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with brominated compounds.

Formula: C₁₄H₁₇BrNO₄

InChI: InChI=1/C14H18BrNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-5-4-6-10(15)7-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/p-1/t11-/m0/s1

SMILES: CC(C)(C)OC(=N[C@@H](Cc1cccc(c1)Br)C(=O)[O-])O

Synonyms:

• Boc-L-3-Bromophenylalanine
• Boc-3-Bromo-L-phenylalanine
• Boc-Phe(3-Br)-OH

Boc-Phe(3-Br)-OH

CAS: 82278-73-7

Formula: C₁₄H₁₈BrNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 344.2010

Ref: IN-DA0038F5

(S)-N-Boc-3-bromophenylalanine

CAS: 82278-73-7

(S)-N-Boc-3-bromophenylalanine

Purity: 98%

Color and Shape: Solid

Molecular weight: 344.20g/mol

Ref: 54-OR914325

Boc-3-bromo-L-phenylalanine

CAS: 82278-73-7

Formula: C₁₄H₁₈BrNO₄

Purity: 95%

Color and Shape: White powder

Molecular weight: 344.205

Ref: 10-F217664

N-Boc-3-bromo-L-phenylalanine, 95%

CAS: 82278-73-7

N-Boc-3-bromo-L-phenylalanine is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU ref

Formula: C₁₄H₁₈BrNO₄

Purity: 95%

Molecular weight: 344.2

Ref: 02-H52024