CAS 82278-73-7
:(S)-N-BOC-3-Bromophenylalanine
Description:
(S)-N-BOC-3-Bromophenylalanine is a derivative of the amino acid phenylalanine, characterized by the presence of a bromine atom at the 3-position of the phenyl ring and a tert-butyloxycarbonyl (BOC) protecting group on the amino group. This compound is typically used in peptide synthesis and medicinal chemistry due to its ability to serve as a building block for more complex molecules. The BOC group provides stability and protects the amino group during synthetic procedures, allowing for selective reactions. The bromine substituent can facilitate further functionalization or serve as a leaving group in nucleophilic substitution reactions. (S)-N-BOC-3-Bromophenylalanine is generally a white to off-white solid and is soluble in organic solvents like dichloromethane and dimethyl sulfoxide. Its chirality, indicated by the (S) designation, is crucial for biological activity, as the stereochemistry can significantly influence the compound's interactions with biological targets. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with brominated compounds.
Formula:C14H17BrNO4
InChI:InChI=1/C14H18BrNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-5-4-6-10(15)7-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/p-1/t11-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](Cc1cccc(c1)Br)C(=O)[O-])O
Synonyms:- Boc-L-3-Bromophenylalanine
- Boc-3-Bromo-L-phenylalanine
- Boc-Phe(3-Br)-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Boc-3-bromo-L-phenylalanine, 95%
CAS:N-Boc-3-bromo-L-phenylalanine is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU refFormula:C14H18BrNO4Purity:95%Molecular weight:344.2Ref: IN-DA0038F5
1g26.00€5g38.00€10g55.00€1kgTo inquire25g95.00€5kgTo inquire100g186.00€500gTo inquire250mg22.00€(S)-N-Boc-3-bromophenylalanine
CAS:(S)-N-Boc-3-bromophenylalaninePurity:98%Color and Shape:SolidMolecular weight:344.20g/molBoc-3-bromo-L-phenylalanine
CAS:Formula:C14H18BrNO4Purity:95%Color and Shape:White powderMolecular weight:344.205



