CAS 82294-72-2
:5-chloro-1-{1-[3-(5-hydroxy-2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)propyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one
Description:
5-Chloro-1-{1-[3-(5-hydroxy-2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)propyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one, with CAS number 82294-72-2, is a complex organic compound characterized by its multi-ring structure, which includes benzimidazole moieties. This substance features a chloro substituent and a hydroxyl group, contributing to its potential biological activity. The presence of a piperidine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound's structure indicates it may exhibit properties such as solubility in organic solvents and potential interactions with various receptors or enzymes, which could be relevant for therapeutic applications. Its molecular weight, stability, and reactivity would depend on the specific functional groups and their arrangement within the molecule. As with many compounds of this nature, further studies would be necessary to fully elucidate its pharmacological properties and potential uses in drug development.
Formula:C22H24ClN5O3
InChI:InChI=1/C22H24ClN5O3/c23-14-2-4-20-17(12-14)25-22(31)28(20)15-6-10-26(11-7-15)8-1-9-27-19-5-3-16(29)13-18(19)24-21(27)30/h2-5,12-13,15,29H,1,6-11H2,(H,24,30)(H,25,31)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

