CAS 823-45-0
:2-(Hydroxymethylene)cyclohexanone
Description:
2-(Hydroxymethylene)cyclohexanone, with the CAS number 823-45-0, is an organic compound characterized by its cyclohexanone structure modified with a hydroxymethylene group. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive odor. It features a ketone functional group, which contributes to its reactivity, particularly in nucleophilic addition reactions. The presence of the hydroxymethylene group enhances its potential for further chemical transformations, making it a valuable intermediate in organic synthesis. It is soluble in organic solvents and exhibits moderate stability under standard conditions. Additionally, 2-(Hydroxymethylene)cyclohexanone can participate in various chemical reactions, including condensation and polymerization, which are significant in the development of pharmaceuticals and fine chemicals. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C7H10O2
InChI:InChI=1S/C7H10O2/c8-5-6-3-1-2-4-7(6)9/h5,8H,1-4H2
InChI key:InChIKey=ORTWDKQPXZLPCA-UHFFFAOYSA-N
SMILES:C(O)=C1C(=O)CCCC1
Synonyms:- (2Z)-2-(hydroxymethylidene)cyclohexanone
- 2-(Hydroxymethylene)cyclohexanone
- 2-(Hydroxymethylidene)cyclohexan-1-one
- Cyclohexanone, 2-(hydroxymethylene)-
- α-(Hydroxymethylene)cyclohexanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.