CAS 82304-99-2

ethyl 3-formyl-4-hydroxybenzoate

Description:

Ethyl 3-formyl-4-hydroxybenzoate, with the CAS number 82304-99-2, is an organic compound that belongs to the class of benzoates. It features a benzoic acid derivative structure, characterized by the presence of an ethyl ester group, a formyl group, and a hydroxy group on the aromatic ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic structure. Ethyl 3-formyl-4-hydroxybenzoate may possess biological activity, making it of interest in pharmaceutical and biochemical research. Its functional groups allow for potential reactivity in various chemical reactions, including condensation and esterification. Additionally, the presence of the hydroxy group can contribute to hydrogen bonding, influencing its physical properties and reactivity. Overall, this compound serves as a valuable intermediate in organic synthesis and may have applications in the development of new materials or therapeutic agents.

Formula: C₁₀H₁₀O₄

InChI: InChI=1/C10H10O4/c1-2-14-10(13)7-3-4-9(12)8(5-7)6-11/h3-6,12H,2H2,1H3

SMILES: CCOC(=O)c1ccc(c(c1)C=O)O

Synonyms:

• Benzoic Acid, 3-Formyl-4-Hydroxy-, Ethyl Ester
• Ethyl 3-formyl-4-hydroxybenzoate

Ethyl 3-formyl-4-hydroxybenzoate

CAS: 82304-99-2

Formula: C₁₀H₁₀O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 194.1840

Ref: IN-DA0055Z1