CymitQuimica logo

CAS 82308-56-3

:

4-cyano-2-(trifluoromethyl)-1H-imidazole-5-carboxamide

Description:
4-Cyano-2-(trifluoromethyl)-1H-imidazole-5-carboxamide is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a cyano group (-CN) and a trifluoromethyl group (-CF3) contributes to its unique chemical properties, including increased lipophilicity and potential for hydrogen bonding. The carboxamide functional group (-CONH2) enhances its solubility in polar solvents and may influence its reactivity and biological activity. This compound is often studied for its potential applications in pharmaceuticals, agrochemicals, and materials science due to its structural features that may confer specific biological activities or interactions. Its molecular structure allows for various synthetic modifications, making it a versatile building block in organic synthesis. Additionally, the trifluoromethyl group is known to enhance metabolic stability and bioactivity, making this compound of interest in medicinal chemistry. Overall, 4-cyano-2-(trifluoromethyl)-1H-imidazole-5-carboxamide exhibits a combination of unique physical and chemical properties that make it significant in various research fields.
Formula:C6H3F3N4O
InChI:InChI=1/C6H3F3N4O/c7-6(8,9)5-12-2(1-10)3(13-5)4(11)14/h(H2,11,14)(H,12,13)
SMILES:C(#N)c1c(C(=O)N)[nH]c(C(F)(F)F)n1
Synonyms:
  • 1H-imidazole-4-carboxamide, 5-cyano-2-(trifluoromethyl)-
  • 5-Cyano-2-(trifluoromethyl)-1H-imidazole-4-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.