CymitQuimica logo

CAS 823188-40-5

:

N-(2-chlorobenzyl)-2-methoxyethanamine

Description:
N-(2-chlorobenzyl)-2-methoxyethanamine is an organic compound characterized by its amine functional group, which contributes to its reactivity and potential biological activity. The presence of a 2-chlorobenzyl group indicates that the compound has a chlorine atom attached to a benzene ring, which can influence its lipophilicity and interaction with biological targets. The methoxyethanamine portion suggests that the compound has ether characteristics, potentially affecting its solubility in organic solvents and water. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can impact its pharmacological profile. Additionally, the structural features may suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific biological activities, toxicity, and stability would require further investigation through experimental studies. As with many organic compounds, safety and handling precautions should be observed due to potential hazards associated with amines and halogenated compounds.
Formula:C10H14ClNO
InChI:InChI=1/C10H14ClNO/c1-13-7-6-12-8-9-4-2-3-5-10(9)11/h2-5,12H,6-8H2,1H3
SMILES:COCCNCc1ccccc1Cl
Synonyms:
  • benzenemethanamine, 2-chloro-N-(2-methoxyethyl)-
  • N-(2-Chlorobenzyl)-2-methoxyethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.