CAS 823188-85-8
:1-(5-chloro-2-methoxyphenyl)-N-methylmethanamine
Description:
1-(5-Chloro-2-methoxyphenyl)-N-methylmethanamine, identified by its CAS number 823188-85-8, is a chemical compound characterized by its unique structure, which includes a methanamine group attached to a substituted phenyl ring. The presence of a chlorine atom and a methoxy group on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and interaction with other molecules. The chlorine substituent can also affect the compound's electronic properties, potentially enhancing its lipophilicity. Due to its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific applications and biological activities would require further investigation through empirical studies. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C9H12ClNO
InChI:InChI=1/C9H12ClNO/c1-11-6-7-5-8(10)3-4-9(7)12-2/h3-5,11H,6H2,1-2H3
SMILES:CNCc1cc(ccc1OC)Cl
Synonyms:- benzenemethanamine, 5-chloro-2-methoxy-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.