CAS 823189-04-4

1-(Azidomethyl)-3,5-dibromobenzene

Description:

1-(Azidomethyl)-3,5-dibromobenzene is an organic compound characterized by the presence of an azidomethyl group and two bromine substituents on a benzene ring. The azidomethyl group (-CH2N3) is known for its reactivity, particularly in click chemistry and other synthetic applications, making this compound valuable in organic synthesis and material science. The dibromobenzene moiety contributes to the compound's hydrophobic nature and can influence its electronic properties, potentially making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of bromine atoms also enhances the compound's reactivity due to the ability of bromine to participate in further chemical transformations. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this compound, as azides can be sensitive and potentially explosive under certain conditions. Overall, 1-(Azidomethyl)-3,5-dibromobenzene is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₇H₅Br₂N₃

InChI: InChI=1S/C7H5Br2N3/c8-6-1-5(4-11-12-10)2-7(9)3-6/h1-3H,4H2

InChI key: InChIKey=XAQDINRXBMSLDJ-UHFFFAOYSA-N

SMILES: C(N=[N+]=[N-])C1=CC(Br)=CC(Br)=C1

Synonyms:

• Benzene, 1-(azidomethyl)-3,5-dibromo-
• 1-(Azidomethyl)-3,5-dibromobenzene