
CAS 823189-81-7
:3,4-Difluoro-N-(1-methylethyl)benzenemethanamine
Description:
3,4-Difluoro-N-(1-methylethyl)benzenemethanamine, with the CAS number 823189-81-7, is an organic compound characterized by its aromatic structure and the presence of fluorine substituents. This compound features a benzene ring with two fluorine atoms located at the 3 and 4 positions, which can influence its reactivity and physical properties, such as polarity and boiling point. The amine functional group contributes to its basicity and potential for hydrogen bonding. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic character, which may affect its solubility in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique combination of functional groups suggests potential applications in pharmaceuticals or agrochemicals, where fluorinated compounds are often valued for their enhanced metabolic stability and bioactivity. As with any chemical, safety data and handling precautions should be considered when working with this substance.
Formula:C10H13F2N
InChI:InChI=1S/C10H13F2N/c1-7(2)13-6-8-3-4-9(11)10(12)5-8/h3-5,7,13H,6H2,1-2H3
InChI key:InChIKey=NQKNBXNLDJXYAJ-UHFFFAOYSA-N
SMILES:C(NC(C)C)C1=CC(F)=C(F)C=C1
Synonyms:- Benzenemethanamine, 3,4-difluoro-N-(1-methylethyl)-
- 3,4-Difluoro-N-(1-methylethyl)benzenemethanamine
- [(3,4-Difluorophenyl)methyl](propan-2-yl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.