
CAS 823189-82-8
:2-Chloro-4-fluoro-N-(1-methylethyl)benzenemethanamine
Description:
2-Chloro-4-fluoro-N-(1-methylethyl)benzenemethanamine, with the CAS number 823189-82-8, is an organic compound characterized by its aromatic structure and the presence of both chlorine and fluorine substituents on the benzene ring. This compound features a secondary amine group, which contributes to its reactivity and potential applications in pharmaceuticals or agrochemicals. The chloro and fluoro groups are known to influence the compound's electronic properties, potentially enhancing its biological activity or altering its solubility. The isopropyl group (1-methylethyl) attached to the nitrogen atom can affect steric hindrance and, consequently, the compound's interaction with biological targets. Generally, compounds with such substituents may exhibit interesting pharmacological properties, making them subjects of interest in medicinal chemistry. Additionally, the presence of halogens can impact the compound's stability and reactivity, influencing its behavior in various chemical environments. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various scientific fields.
Formula:C10H13ClFN
InChI:InChI=1S/C10H13ClFN/c1-7(2)13-6-8-3-4-9(12)5-10(8)11/h3-5,7,13H,6H2,1-2H3
InChI key:InChIKey=KPFQCDBZECWZSW-UHFFFAOYSA-N
SMILES:C(NC(C)C)C1=C(Cl)C=C(F)C=C1
Synonyms:- Benzenemethanamine, 2-chloro-4-fluoro-N-(1-methylethyl)-
- 2-Chloro-4-fluoro-N-(1-methylethyl)benzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.