CymitQuimica logo

CAS 823221-95-0

:

Pyridine, 5-chloro-4-iodo-2-(trifluoromethyl)-

Description:
Pyridine, 5-chloro-4-iodo-2-(trifluoromethyl)-, with the CAS number 823221-95-0, is a heterocyclic aromatic compound characterized by a six-membered ring containing one nitrogen atom. This compound features a trifluoromethyl group (-CF3), which is known for its electron-withdrawing properties, enhancing the compound's reactivity. The presence of chlorine and iodine substituents at the 5 and 4 positions, respectively, contributes to its unique chemical behavior, potentially influencing its reactivity in nucleophilic substitution reactions. Pyridine derivatives often exhibit diverse biological activities, making them of interest in medicinal chemistry. The trifluoromethyl group can also enhance lipophilicity, affecting the compound's solubility and permeability. Additionally, the compound's structure suggests potential applications in agrochemicals or pharmaceuticals, where halogenated pyridines are frequently utilized. Overall, this compound's distinct functional groups and heterocyclic nature make it a valuable subject for further research in various chemical applications.
Formula:C6H2ClF3IN
InChI:InChI=1S/C6H2ClF3IN/c7-3-2-12-5(1-4(3)11)6(8,9)10/h1-2H
InChI key:FOHPNORRPVAVJB-UHFFFAOYSA-N
SMILES:C1=C(C(=CN=C1C(F)(F)F)Cl)I
Found 5 products.