
CAS 823221-98-3
:4,5-Dichloro-2-(trifluoromethyl)pyridine
Description:
4,5-Dichloro-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two chlorine atoms and a trifluoromethyl group. Its molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The presence of the dichloro and trifluoromethyl groups enhances its lipophilicity and may influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is important to handle it with care due to potential toxicity and environmental impact. The compound's reactivity can be attributed to the electron-withdrawing nature of the trifluoromethyl group, which can affect its interaction with nucleophiles. Overall, 4,5-Dichloro-2-(trifluoromethyl)pyridine is a valuable compound in synthetic chemistry, particularly in the development of new materials and active pharmaceutical ingredients.
Formula:C6H2Cl2F3N
InChI:InChI=1S/C6H2Cl2F3N/c7-3-1-5(6(9,10)11)12-2-4(3)8/h1-2H
InChI key:InChIKey=MHTGNEWMJUHDIF-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(Cl)=C(Cl)C=N1
Synonyms:- 4,5-Dichloro-2-(trifluoromethyl)pyridine
- Pyridine, 4,5-dichloro-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.