CymitQuimica logo

CAS 823222-03-3

:

2-Bromo-5-(trifluoromethyl)-4-pyridinecarboxylic acid

Description:
2-Bromo-5-(trifluoromethyl)-4-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2-position with a bromine atom and at the 5-position with a trifluoromethyl group. The presence of the carboxylic acid functional group at the 4-position contributes to its acidic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the bromine atom can serve as a site for further chemical modifications. The compound's unique structure may impart specific reactivity patterns, making it useful in various synthetic pathways. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2-Bromo-5-(trifluoromethyl)-4-pyridinecarboxylic acid is a valuable compound in research and development contexts.
Formula:C7H3BrF3NO2
InChI:InChI=1S/C7H3BrF3NO2/c8-5-1-3(6(13)14)4(2-12-5)7(9,10)11/h1-2H,(H,13,14)
InChI key:InChIKey=WHSHCWILIXJEGV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C(F)(F)F)=CN=C(Br)C1
Synonyms:
  • 2-Bromo-5-(trifluoromethyl)-4-pyridinecarboxylic acid
  • 4-Pyridinecarboxylic acid, 2-bromo-5-(trifluoromethyl)-
  • 2-Bromo-5-(trifluoromethyl)isonicotinic acid
Found 4 products.