CAS 82326-46-3
:2-[(3,4-Dimethylphenoxy)methyl]-1H-benzimidazole
Description:
2-[(3,4-Dimethylphenoxy)methyl]-1H-benzimidazole, with the CAS number 82326-46-3, is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a 3,4-dimethylphenoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the benzimidazole moiety often suggests potential applications in pharmaceuticals, particularly as a scaffold for drug development due to its ability to interact with biological targets. Additionally, the dimethylphenoxy substituent may enhance lipophilicity, influencing the compound's solubility and permeability. The compound's characteristics, including its melting point, solubility, and reactivity, would depend on the specific functional groups and their arrangement within the molecular structure. Overall, 2-[(3,4-Dimethylphenoxy)methyl]-1H-benzimidazole represents a class of compounds that may possess interesting chemical and biological properties, warranting further investigation for potential applications in medicinal chemistry.
Formula:C16H16N2O
InChI:InChI=1S/C16H16N2O/c1-11-7-8-13(9-12(11)2)19-10-16-17-14-5-3-4-6-15(14)18-16/h3-9H,10H2,1-2H3,(H,17,18)
InChI key:InChIKey=UMKDQBOTXZSEJU-UHFFFAOYSA-N
SMILES:C(OC1=CC(C)=C(C)C=C1)C=2NC=3C(N2)=CC=CC3
Synonyms:- 2-(3,4-Dimethylphenoxymethyl)-1H-1,3-benzodiazole
- 1H-Benzimidazole, 2-[(3,4-dimethylphenoxy)methyl]-
- 2-[(3,4-Dimethylphenoxy)methyl]-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.