CAS 82330-54-9
:2-chloro-3,4-dimethoxy-6-nitrobenzaldehyde
Description:
2-Chloro-3,4-dimethoxy-6-nitrobenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. The presence of a chlorine atom and a nitro group on the benzene ring, along with two methoxy groups, contributes to its unique chemical properties. This compound typically appears as a yellow to orange solid and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic characteristics. The nitro group is known for its electron-withdrawing properties, which can influence the reactivity of the compound in various chemical reactions, including electrophilic substitution. Additionally, the methoxy groups can provide electron-donating effects, affecting the overall electronic distribution within the molecule. This compound may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential reactivity and functional groups. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C9H8ClNO5
InChI:InChI=1/C9H8ClNO5/c1-15-7-3-6(11(13)14)5(4-12)8(10)9(7)16-2/h3-4H,1-2H3
SMILES:COc1cc(c(C=O)c(c1OC)Cl)N(=O)=O
Synonyms:- Benzaldehyde, 2-Chloro-3,4-Dimethoxy-6-Nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-chloro-3,4-dimethoxy-6-nitrobenzaldehyde
CAS:2-chloro-3,4-dimethoxy-6-nitrobenzaldehydePurity:≥95%Molecular weight:245.62g/mol2-Chloro-3,4-dimethoxy-6-nitrobenzaldehyde
CAS:2-Chloro-3,4-dimethoxy-6-nitrobenzaldehyde is a fine chemical with a CAS number of 82330-54-9. It is a versatile building block that can be used as a reagent or intermediate for the production of other chemicals. This product has been shown to have many different reactions. It is useful in the synthesis of complex compounds and offers high quality and purity.Formula:C9H8ClNO5Purity:Min. 95%Color and Shape:PowderMolecular weight:245.62 g/mol


