CAS 82337-46-0

12(R)-HETE

Description:

12(R)-HETE, or 12-hydroxyeicosatetraenoic acid, is a bioactive lipid belonging to the family of eicosanoids, which are derived from arachidonic acid. This compound is characterized by its hydroxyl group at the 12th carbon position of the eicosatetraenoic acid backbone, specifically in the R configuration. It plays a significant role in various physiological processes, including inflammation, cell signaling, and vascular function. 12(R)-HETE is known to act as a signaling molecule, influencing cellular responses such as proliferation and migration, particularly in immune and endothelial cells. Its production is often associated with the activity of lipoxygenases, enzymes that catalyze the oxidation of polyunsaturated fatty acids. Additionally, 12(R)-HETE has been studied for its potential implications in various pathological conditions, including cancer and cardiovascular diseases. As a relatively specific metabolite, it serves as a valuable biomarker in research related to lipid metabolism and inflammatory responses.

Formula: C₂₀H₃₂O₃

InChI: InChI=1S/C20H32O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h7-11,13-14,17,19,21H,2-6,12,15-16,18H2,1H3,(H,22,23)/b9-7-,11-8-,13-10-,17-14+/t19-/m1/s1

InChI key: InChIKey=ZNHVWPKMFKADKW-ZYBDYUKJSA-N

SMILES: C(\[C@@H](C/C=C\CCCCC)O)=C/C=C\C/C=C\CCCC(O)=O

Synonyms:

• 12(R)-HETE
• (5Z,8Z,10E,12R,14Z)-12-Hydroxy-5,8,10,14-eicosatetraenoic acid
• 5,8,10,14-Eicosatetraenoic acid, 12-hydroxy-, [R-(E,Z,Z,Z)]-
• 12-HETE
• 5,8,10,14-Eicosatetraenoic acid, 12-hydroxy-, (5Z,8Z,10E,12R,14Z)-

12(R)-hydroxy-5(Z),8(Z),10(E),14(Z)-eicosatetraenoic acid

CAS: 82337-46-0

Formula: C20H32O3

Purity: >98%

Color and Shape: In solution, Ethanol

Molecular weight: 320.47

Ref: 48-14-6044

12(R)-Hydroxy-5(Z),8(Z),10(E),14(Z)-eicosatetraenoic acid

CAS: 82337-46-0

12(R)-Hydroxy-5(Z),8(Z),10(E),14(Z)-eicosatetraenoic acid is a specialized eicosanoid, which is a type of bioactive lipid mediator derived from arachidonic acid. It is primarily produced via the enzymatic action of lipoxygenase pathways in various cell types, including leukocytes and endothelial cells. This compound exhibits specific stereochemistry and positional isomerism that are essential for its biological functions.

Formula: C₂₀H₃₂O₃

Purity: Min. 95%

Molecular weight: 320.5 g/mol

Ref: 3D-HDA33746

12(R)-HETE

CAS: 82337-46-0

12(R)-HETE made in invertebrates by lipoxygenation, in mammals by 12(R)-LOs/CYP450. Mainly proinflammatory, attracts leukocytes, reduces rabbit eye pressure.

Formula: C₂₀H₃₂O₃

Color and Shape: Solid

Molecular weight: 320.47

Ref: TM-T36145