CAS 82343-79-1
:2-(Diethylaminomethyl)cyclopentanone hydrochloride
Description:
2-(Diethylaminomethyl)cyclopentanone hydrochloride, with the CAS number 82343-79-1, is a chemical compound characterized by its cyclic structure and the presence of a diethylamino group. This compound typically appears as a white to off-white crystalline solid, which is soluble in water and various organic solvents, reflecting its polar nature due to the hydrochloride salt formation. The presence of the cyclopentanone moiety contributes to its potential reactivity, particularly in nucleophilic substitution reactions. As a hydrochloride salt, it exhibits enhanced stability and solubility compared to its free base form. This compound may be of interest in medicinal chemistry and pharmacology, potentially serving as a precursor or intermediate in the synthesis of various pharmaceuticals. Its specific biological activity and applications would depend on further research and characterization, including studies on its pharmacokinetics and pharmacodynamics. Safety data should be consulted to understand its handling and toxicity profiles, as with any chemical substance.
Formula:C10H20ClNO
InChI:InChI=1/C10H19NO.ClH/c1-3-11(4-2)8-9-6-5-7-10(9)12;/h9H,3-8H2,1-2H3;1H
SMILES:CCN(CC)CC1CCCC1=O.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.