CymitQuimica logo

CAS 82344-98-7

:

qfitc mixed isomers

Description:
QFITC mixed isomers, identified by the CAS number 82344-98-7, is a fluorescent dye commonly used in biological and biochemical applications, particularly in labeling proteins and other biomolecules for fluorescence microscopy and flow cytometry. This compound is characterized by its ability to emit light upon excitation, typically in the green spectrum, making it suitable for various imaging techniques. The mixed isomers indicate that the substance consists of multiple structural variations, which can influence its photophysical properties, such as absorption and emission wavelengths, as well as its stability and reactivity. QFITC is known for its high quantum yield and photostability, which are essential for reliable imaging over extended periods. Additionally, it is often utilized in conjugation with antibodies or other biomolecules, allowing for specific targeting in complex biological systems. Safety considerations should be taken into account when handling this compound, as with many fluorescent dyes, due to potential toxicity and environmental impact.
Formula:C33H29N3O3S
InChI:InChI=1/C33H29N3O3S/c37-32-24-17-21(34-18-40)9-10-25(24)33(39-32)26-15-19-5-1-11-35-13-3-7-22(28(19)35)30(26)38-31-23-8-4-14-36-12-2-6-20(29(23)36)16-27(31)33/h9-10,15-17H,1-8,11-14H2
SMILES:C1Cc2cc3c(c4CCCN(C1)c24)Oc1c2CCCN4CCCc(cc1C13c3ccc(cc3C(=O)O1)N=C=S)c24
Synonyms:
  • XRITC, Pure
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.