CAS 82351-05-1

(2E)-3-(3,4-dichlorophenyl)-N-(1-methylpropyl)prop-2-enamide

Description:

The chemical substance known as (2E)-3-(3,4-dichlorophenyl)-N-(1-methylpropyl)prop-2-enamide, with the CAS number 82351-05-1, is an organic compound characterized by its amide functional group and a conjugated double bond system. It features a prop-2-enamide backbone, which contributes to its potential reactivity and stability under various conditions. The presence of the 3,4-dichlorophenyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The N-(1-methylpropyl) substituent adds steric bulk, which can affect the compound's interaction with biological targets. This compound may exhibit properties such as moderate to high solubility in organic solvents, and its stability can be influenced by environmental factors like pH and temperature. Additionally, due to its structural characteristics, it may participate in various chemical reactions, including nucleophilic substitutions and conjugations. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and material science.

Formula: C₁₃H₁₅Cl₂NO

InChI: InChI=1/C13H15Cl2NO/c1-3-9(2)16-13(17)7-5-10-4-6-11(14)12(15)8-10/h4-9H,3H2,1-2H3,(H,16,17)/b7-5+

Synonyms:

• (2E)-N-sec-Butyl-3-(3,4-dichlorophenyl)acrylamide
• 2-propenamide, 3-(3,4-dichlorophenyl)-N-(1-methylpropyl)-, (2E)-

2-Propenamide, 3-(3,4-dichlorophenyl)-N-(1-methylpropyl)-

CAS: 82351-05-1

Formula: C₁₃H₁₅Cl₂NO

Purity: 99%

Color and Shape: Solid

Molecular weight: 272.1703

Ref: IN-DA005DNS

Lvguidingan

CAS: 82351-05-1

Lvguidingan

Purity: ≥98%

Molecular weight: 272.17g/mol

Ref: 54-BUP15594

Lvguidingan

CAS: 82351-05-1

Lvguidingan is an Anticonvulsant agent.

Formula: C₁₃H₁₅Cl₂NO

Purity: 99.53% - 99.87%

Color and Shape: Solid

Molecular weight: 272.17

Ref: TM-T3563

Lvguidingan

CAS: 82351-05-1

Purity: 98%

Molecular weight: 272.17

Ref: 10-F986326