CAS 82354-38-9
:Gelsenicine
Description:
Gelsenicine is a naturally occurring alkaloid derived from the plant Gelsemium elegans, known for its potent pharmacological properties. It is classified as a neuromuscular blocking agent and has been studied for its potential therapeutic applications, particularly in pain management and as an anesthetic. The compound exhibits a complex molecular structure, which contributes to its biological activity. Gelsenicine interacts with nicotinic acetylcholine receptors, leading to muscle paralysis, making it of interest in both medical and research settings. Its effects can be dose-dependent, and while it shows promise in certain applications, it also poses risks of toxicity and adverse effects, necessitating careful handling and dosage regulation. The compound's CAS number, 82354-38-9, is a unique identifier that facilitates its recognition in chemical databases and regulatory frameworks. Overall, gelsenicine represents a significant area of study within pharmacology, particularly in the context of neuromuscular interactions and potential therapeutic uses.
Formula:C19H22N2O3
InChI:InChI=1S/C19H22N2O3/c1-3-14-11-8-17-19(9-15(20-14)12(11)10-24-17)13-6-4-5-7-16(13)21(23-2)18(19)22/h4-7,11-12,15,17H,3,8-10H2,1-2H3/t11-,12+,15+,17-,19+/m1/s1
InChI key:InChIKey=BIGABVPVCRHEES-NWPJSNQLSA-N
SMILES:O=C1[C@@]2(C=3C(N1OC)=CC=CC3)[C@]4(C[C@@]5([C@@]([C@](C2)(N=C5CC)[H])(CO4)[H])[H])[H]
Synonyms:- Spiro[3H-indole-3,7′(6′H)-[3,6]methano[3H]oxepino[4,3-b]pyrrol]-2(1H)-one, 2′-ethyl-3′a,4′,8′,8′a-tetrahydro-1-methoxy-, (3S,3′R,3′aS,6′R,8′aS)-
- (3S,3′R,3′aS,6′R,8′aS)-2′-Ethyl-3′a,4′,8′,8′a-tetrahydro-1-methoxyspiro[3H-indole-3,7′(6′H)-[3,6]methano[3H]oxepino[4,3-b]pyrrol]-2(1H)-one
- Gelsedine, 4,20-didehydro-
- Humantenmine
- Spiro[3H-indole-3,7′(6′H)-[3,6]methano[3H]oxepino[4,3-b]pyrrol]-2(1H)-one, 2′-ethyl-3′a,4′,8′,8′a-tetrahydro-9′-hydroxy-1-methoxy-, [3′R-(3′α,3′aβ,6′α,7′α,8′aβ)]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(3S,3'R,3a'S,6'R,8a'S)-2'-Ethyl-1-methoxy-3a',4',8',8a'-tetrahydro-3'H,6'H-spiro[indoline-3,7'-[3,6]methanooxepino[4,3-b]pyrrol]-2-one
CAS:Formula:C19H22N2O3Purity:95%Molecular weight:326.3896Humantenmine
CAS:1. Humantenmine is a toxic compound isolated from Gelsemium elegans Benth . 2. Humantenmine and koumine may inhibit several CYP450 enzyme activities.Formula:C19H22N2O3Purity:99.13% - 99.51%Color and Shape:SolidMolecular weight:326.39Ref: TM-T2S0663
1mg46.00€5mg133.00€10mg205.00€25mg350.00€50mg520.00€100mg745.00€200mg1,018.00€1mL*10mM (DMSO)130.00€Gelsenicine
CAS:Gelsenicine is a dpp-iv inhibitor that has been shown to be effective in the treatment of bone cancer. Gelsenicine binds to an enzyme called dpp-iv, which inhibits the production of acetylcholine and thus reduces inflammation. It also prevents the production of lc-ms/ms method, which may be due to its ability to inhibit the activity of histone deacetylases and protein kinase C. Gelsenicine has also been found to be active against autoimmune diseases, such as rheumatoid arthritis and psoriasis. This drug is most commonly used in China for treating these conditions.Formula:C19H22N2O3Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:326.39 g/mol





