CAS 82356-80-7

Di-n-butyl-1,1,3,3-tetramethyldisilazane

Description:

Di-n-butyl-1,1,3,3-tetramethyldisilazane is a chemical compound characterized by its silazane structure, which features silicon-nitrogen bonds. It is typically a colorless to pale yellow liquid with a distinctive odor. This compound is known for its utility as a precursor in the synthesis of silicon-containing materials and as a surface modifier in various applications, including coatings and sealants. Its molecular structure includes two n-butyl groups and two trimethylsilyl groups attached to a disilazane framework, contributing to its unique properties. Di-n-butyl-1,1,3,3-tetramethyldisilazane exhibits good thermal stability and can act as a coupling agent, enhancing the adhesion of materials. It is also soluble in organic solvents, making it versatile for various chemical processes. However, like many silazanes, it may pose health and environmental risks, necessitating careful handling and appropriate safety measures during use. Overall, this compound plays a significant role in materials science and chemical manufacturing.

Formula: C₁₂H₃₁NSi₂

InChI: InChI=1/C12H31NSi2/c1-7-9-11-14(3,4)13-15(5,6)12-10-8-2/h13H,7-12H2,1-6H3

SMILES: CCCC[Si](C)(C)N[Si](C)(C)CCCC

Synonyms:

• 1,3-Di-n-butyl-1,1,3,3-tetramethyldisilazane
• 1-butyl-N-[butyl(dimethyl)silyl]-1,1-dimethylsilanamine