CAS 82372-35-8
:3-(diethylamino)-1,5-dihydro-2,4,3-ben-zodioxaphosphepin
Description:
3-(Diethylamino)-1,5-dihydro-2,4,3-benzodioxaphosphepin, with CAS number 82372-35-8, is a chemical compound that belongs to the class of organophosphorus compounds. It features a unique bicyclic structure that incorporates both phosphorus and oxygen atoms, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the diethylamino group enhances its solubility and reactivity, making it a versatile intermediate in organic synthesis. This compound is characterized by its relatively low molecular weight and specific stereochemistry, which can influence its biological activity and interaction with other molecules. Additionally, it may exhibit properties such as moderate stability under standard conditions, but its reactivity can vary depending on the surrounding environment and functional groups present. Safety data should be consulted for handling and storage, as organophosphorus compounds can sometimes pose health risks. Overall, the unique structural features of this compound make it of interest for further research and development in chemical applications.
Formula:C12H18NO2P
InChI:InChI=1/C12H18NO2P/c1-3-13(4-2)16-14-9-11-7-5-6-8-12(11)10-15-16/h5-8H,3-4,9-10H2,1-2H3
SMILES:CCN(CC)P1OCc2ccccc2CO1
Synonyms:- 3-(Diethylamino)-1,5-dihydro-2,4,3-benzodioxaphosphepin
- N,N-diethyl-1,5-dihydro-2,4,3-benzodioxa-phosphep
- o-Xylylene N,N-diethylphosphoramidite
- N,N-diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine
- N,N-diethyl-1,5-dihydrobenzo[e][1,3,2]dioxaphosphepin-3-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(Diethylamino)-1,5-dihydro-2,4,3-benzodioxaphosphepin
CAS:Formula:C12H18NO2PPurity:97%Color and Shape:SolidMolecular weight:239.25063-(Diethylamino)-1,5-dihydro-2,4,3-benzodioxaphosphepin
CAS:3-(Diethylamino)-1,5-dihydro-2,4,3-benzodioxaphosphepinPurity:97%Molecular weight:239.25g/mol3-(Diethylamino)-1,5-dihydro-2,4,3-benzodioxaphosphepin
CAS:<p>3-(Diethylamino)-1,5-dihydro-2,4,3-benzodioxaphosphepin is a reagent used in the hydrogenolysis of alcohols. It is insoluble in water but soluble in organic solvents. 3-(Diethylamino)-1,5-dihydro-2,4,3-benzodioxaphosphepin has been used to prepare a number of alcohols including pyridinium and polyhydroxy alcohols. The compound has also been shown to be a messenger molecule that can induce transduction when it binds to the receptor protein.</p>Formula:C12H18NO2PPurity:Min. 95%Molecular weight:239.25 g/mol



