CAS 82375-29-9

Humantenine

Description:

Humantenine, with the CAS number 82375-29-9, is a chemical compound that belongs to the class of alkaloids, which are naturally occurring organic compounds that mostly contain basic nitrogen atoms. Alkaloids are known for their pharmacological effects and are often derived from plants. Humantenine is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. This compound has been studied for its potential therapeutic properties, including effects on the central nervous system and possible applications in treating various health conditions. Its solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. As with many alkaloids, humantenine may exhibit a range of biological activities, making it a subject of interest in medicinal chemistry and pharmacology. However, detailed studies on its specific properties, mechanisms of action, and potential applications are essential for a comprehensive understanding of its role in science and medicine.

Formula: C₂₁H₂₆N₂O₃

InChI: InChI=1S/C21H26N2O3/c1-4-13-11-22(2)18-10-21(19-9-14(13)15(18)12-26-19)16-7-5-6-8-17(16)23(25-3)20(21)24/h4-8,14-15,18-19H,9-12H2,1-3H3/b13-4+/t14-,15-,18-,19+,21-/m0/s1

InChI key: InChIKey=SJKRPUOXUNOPOP-YDAOCWKESA-N

SMILES: O=C1[C@@]2(C=3C(N1OC)=CC=CC3)[C@]4(C[C@@]\5([C@@]([C@](C2)(N(C)C/C5=C\C)[H])(CO4)[H])[H])[H]

Synonyms:

• Humantenine
• [4′R-(3′Z,4′α,4′aβ,7′α,8′α,9′aβ)]-3′-Ethylidene-1′,2′,3′,4′,4′a,5′,9′,9′a-octahydro-1-methoxy-1′-methylspiro[3H-indole-3,8′(7′H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one
• Spiro[3H-indole-3,8′(7′H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3′-ethylidene-1′,2′,3′,4′,4′a,5′,9′,9′a-octahydro-1-methoxy-1′-methyl-, [4′R-(3′Z,4′α,4′aβ,7′α,8′α,9′aβ)]-
• (3S,3′Z,4′R,4′aS,7′R,9′aS)-3′-Ethylidene-1′,2′,3′,4′,4′a,5′,9′,9′a-octahydro-1-methoxy-1′-methylspiro[3H-indole-3,8′(7′H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one
• Spiro[3H-indole-3,8′(7′H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3′-ethylidene-1′,2′,3′,4′,4′a,5′,9′,9′a-octahydro-1-methoxy-1′-methyl-, (3S,3′Z,4′R,4′aS,7′R,9′aS)-

Humantenine

CAS: 82375-29-9

Formula: C₂₁H₂₆N₂O₃

Purity: ≥ 98.0%

Color and Shape: White or off-white powder

Molecular weight: 354.45

Ref: 7W-GY3525

Humantenine

CAS: 82375-29-9

Humantenine from Gelsemium elegans causes HCT116 cell injury by disrupting m6A regulator mRNA expression.

Formula: C₂₁H₂₆N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 354.44

Ref: TM-TN1747

Humantenine

CAS: 82375-29-9

Formula: C₂₁H₂₆N₂O₃

Purity: 95%~99%

Molecular weight: 354.45

Ref: BP-BP4258

Humantenine

CAS: 82375-29-9

Humantenine is a synthetic peptide, derived from human sources, specifically engineered for therapeutic research. This peptide operates by mimicking or influencing naturally occurring biological processes within the human body. With its capacity to interact at a molecular level, Humantenine can potentially modulate cellular pathways, offering opportunities for novel therapeutic approaches.

Formula: C₂₁H₂₆N₂O₃

Purity: Min. 95%

Molecular weight: 354.4 g/mol

Ref: 3D-HDA37529