CymitQuimica logo

CAS 82380-17-4

:

Benzonitrile, 2-bromo-4-hydroxy-

Description:
Benzonitrile, 2-bromo-4-hydroxy- is an organic compound characterized by the presence of a benzonitrile group, a bromine atom, and a hydroxyl group on the aromatic ring. Its molecular structure features a cyano group (-C≡N) attached to a benzene ring, which is further substituted at the 2-position with a bromine atom and at the 4-position with a hydroxyl group (-OH). This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the hydroxyl group contributes to its reactivity, allowing for various chemical transformations. Additionally, the bromine substituent can enhance its electrophilic character, making it useful in further chemical reactions. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal measures should be observed.
Formula:C7H4BrNO
InChI:InChI=1S/C7H4BrNO/c8-7-3-6(10)2-1-5(7)4-9/h1-3,10H
InChI key:CGPTZCZFFUYDCB-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1O)Br)C#N
Synonyms:
  • 2-bromo-4-hydroxybenzonitrile
Found 4 products.