CymitQuimica logo

CAS 82381-77-9

:

5-[(2-methoxyethyl)sulfanyl]-1,3,4-thiadiazol-2-amine

Description:
5-[(2-Methoxyethyl)sulfanyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a sulfanyl group. The presence of the thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are known for their diverse pharmacological properties. The methoxyethyl substituent enhances its solubility and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its functional groups suggest potential reactivity, particularly in nucleophilic substitution reactions. The compound's CAS number, 82381-77-9, allows for easy identification in chemical databases and literature. Due to its structural features, it may be of interest in medicinal chemistry and material science, although specific applications would depend on further research into its properties and biological effects. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C5H9N3OS2
InChI:InChI=1/C5H9N3OS2/c1-9-2-3-10-5-8-7-4(6)11-5/h2-3H2,1H3,(H2,6,7)
SMILES:COCCSc1n[nH]c(=N)s1
Synonyms:
  • 1,3,4-Thiadiazol-2-Amine, 5-[(2-Methoxyethyl)Thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.