CAS 823817-56-7
:3-amino-1-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-4-(2,4,5-trifluorophenyl)butan-1-one
Description:
3-amino-1-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-4-(2,4,5-trifluorophenyl)butan-1-one, with CAS number 823817-56-7, is a complex organic compound characterized by its unique structural features, including a triazolo-pyrazine core and multiple trifluoromethyl and trifluorophenyl substituents. This compound exhibits significant biological activity, often investigated for its potential therapeutic applications, particularly in the fields of medicinal chemistry and pharmacology. The presence of amino and carbonyl functional groups contributes to its reactivity and solubility properties, making it a candidate for various chemical reactions. The trifluoromethyl groups enhance lipophilicity and metabolic stability, which can influence the compound's pharmacokinetics. Additionally, the intricate arrangement of heterocycles may impart specific interactions with biological targets, making it a subject of interest in drug design. Overall, this compound exemplifies the complexity and diversity of modern synthetic organic chemistry, with potential implications in drug discovery and development.
Formula:C16H15F6N5O
InChI:InChI=1/C16H15F6N5O/c17-10-6-12(19)11(18)4-8(10)3-9(23)5-14(28)26-1-2-27-13(7-26)24-25-15(27)16(20,21)22/h4,6,9H,1-3,5,7,23H2
SMILES:C1Cn2c(CN1C(=O)CC(Cc1cc(c(cc1F)F)F)N)nnc2C(F)(F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Sitagliptin impurity E
CAS:Sitagliptin impurity E is an inhibitor of dipeptidyl peptidase-4 (DPP-IV) that is used as a hypoglycemic agent. Sitagliptin impurity E has been shown to increase the glucose-lowering effect in diabetic patients with type 2 diabetes mellitus. It is also effective in reducing postprandial glucose and insulin levels. Sitagliptin impurity E has been shown to increase the concentration of insulin in plasma for up to 24 hours after administration, which suggests that it may be useful for the treatment of metabolic disorders such as obesity and type 2 diabetes mellitus.
Formula:C16H15F6N5OPurity:Min. 95%Molecular weight:407.31 g/mol

