CymitQuimica logo

CAS 823817-58-9

:

1,2,4-Triazolo[4,3-a]pyrazine,7-[(3S)-3-amino-1-oxo-4-(2,4,5-trifluorophenyl)butyl]-5,6,7,8-tetrahydro-3-(trifluoromethyl)-, phosphate (1:1)

Description:
1,2,4-Triazolo[4,3-a]pyrazine, 7-[(3S)-3-amino-1-oxo-4-(2,4,5-trifluorophenyl)butyl]-5,6,7,8-tetrahydro-3-(trifluoromethyl)-, phosphate (1:1) is a complex organic compound characterized by its unique structural features, including a triazole and pyrazine ring system. The presence of trifluoromethyl and trifluorophenyl groups contributes to its lipophilicity and potential biological activity. The compound also contains an amino acid derivative, which may enhance its interaction with biological targets, making it of interest in pharmaceutical research. As a phosphate derivative, it may exhibit properties relevant to enzyme inhibition or modulation. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutics targeting specific pathways. Its CAS number, 823817-58-9, allows for precise identification in chemical databases. Overall, this compound's intricate design and functional groups suggest a promising profile for further investigation in drug development and related fields.
Formula:C16H15F6N5O・H3O4P
InChI:InChI=1S/C16H15F6N5O.H3O4P/c17-10-6-12(19)11(18)4-8(10)3-9(23)5-14(28)26-1-2-27-13(7-26)24-25-15(27)16(20,21)22;1-5(2,3)4/h4,6,9H,1-3,5,7,23H2;(H3,1,2,3,4)/t9-;/m0./s1
InChI key:IQFYVLUXQXSJJN-FVGYRXGTSA-N
SMILES:C1CN2C(=NN=C2C(F)(F)F)CN1C(=O)C[C@H](CC3=CC(=C(C=C3F)F)F)N.OP(=O)(O)O
Found 10 products.