CAS 82386-90-1

5-Chloro-2-iodobenzenemethanol

Description:

5-Chloro-2-iodobenzenemethanol, with the CAS number 82386-90-1, is an organic compound characterized by the presence of both chlorine and iodine substituents on a benzene ring, along with a hydroxymethyl group (-CH2OH) attached to the aromatic system. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of halogens (chlorine and iodine) can influence its reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The hydroxymethyl group contributes to its solubility in polar solvents and can participate in hydrogen bonding, affecting its physical properties. Additionally, the compound's structure suggests potential biological activity, which may warrant further investigation in pharmacological contexts. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.

Formula: C₇H₆ClIO

InChI: InChI=1S/C7H6ClIO/c8-6-1-2-7(9)5(3-6)4-10/h1-3,10H,4H2

InChI key: InChIKey=MGLGJZWGRMOAJS-UHFFFAOYSA-N

SMILES: C(O)C1=C(I)C=CC(Cl)=C1

Synonyms:

• 5-Chloro-2-iodobenzenemethanol
• Benzenemethanol, 5-chloro-2-iodo-
• 5-Chloro-2-iodobenzyl alcohol
• (5-Chloro-2-iodophenyl)methanol

Benzenemethanol, 5-chloro-2-iodo-

CAS: 82386-90-1

Formula: C₇H₆ClIO

Purity: 98%

Molecular weight: 268.4794

Ref: IN-DA008K0A

(5-Chloro-2-iodophenyl)methanol

CAS: 82386-90-1

(5-Chloro-2-iodophenyl)methanol

Purity: 98%

Molecular weight: 268.48g/mol

Ref: 54-OR1036134

(5-Chloro-2-iodophenyl)methanol

CAS: 82386-90-1

Purity: 98%

Molecular weight: 268.480011

Ref: 10-F658835

(5-Chloro-2-iodophenyl)methanol

CAS: 82386-90-1

Versatile small molecule scaffold

Formula: C₇H₆ClIO

Purity: Min. 95%

Molecular weight: 268.48 g/mol

Ref: 3D-HDA38690