CymitQuimica logo

CAS 824-24-8

:

4-Methyl-7-azaindole

Description:
4-Methyl-7-azaindole is a heterocyclic organic compound characterized by its fused indole and pyridine structures, incorporating a nitrogen atom in the ring system. It features a methyl group at the 4-position of the indole moiety, which influences its chemical reactivity and properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The presence of the nitrogen atom in the ring enhances its basicity and can influence its electronic properties, making it a subject of interest in various chemical research fields. Additionally, 4-Methyl-7-azaindole may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, which are common in heterocyclic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H8N2
InChI:InChI=1/C8H8N2/c1-6-2-4-9-8-7(6)3-5-10-8/h2-5H,1H3,(H,9,10)
InChI key:KEBIZMQVCXHCGN-UHFFFAOYSA-N
SMILES:Cc1ccnc2c1cc[nH]2
Synonyms:
  • 4-Methyl-1H-pyrrolo[2,3-b]pyridine
Found 4 products.