
CAS 824-35-1
:Calcium salicylate
Description:
Calcium salicylate, with the CAS number 824-35-1, is a chemical compound formed from calcium and salicylic acid. It typically appears as a white to off-white crystalline powder and is known for its solubility in water, which can vary depending on the pH of the solution. This compound exhibits anti-inflammatory and analgesic properties, making it useful in various pharmaceutical applications, particularly in topical formulations for pain relief. Calcium salicylate is also recognized for its role in calcium supplementation, as it can provide both calcium and salicylate ions. In terms of stability, it is generally stable under normal conditions but should be stored in a cool, dry place away from incompatible substances. Its safety profile indicates that while it can be beneficial in therapeutic contexts, it should be used with caution, particularly in individuals with salicylate sensitivity or certain medical conditions. Overall, calcium salicylate serves as an important compound in both medicinal chemistry and nutritional supplementation.
Formula:C7H6O3Ca
InChI:InChI=1S/C7H6O3.Ca/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);
InChI key:InChIKey=JYUXOLTYMOTEFQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C=CC=C1.[Ca]
Synonyms:- Calcium salicylate
- Benzoic acid, 2-hydroxy-, calcium salt (2:1)
- Helioscin
- Cyl-Re
- Salicylic acid, calcium salt (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.