CAS 824-48-6

N-(2-Fluorophenyl)formamide

Description:

N-(2-Fluorophenyl)formamide, with the CAS number 824-48-6, is an organic compound characterized by the presence of a formamide functional group attached to a 2-fluorophenyl moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a molecular formula that reflects the presence of both carbon and nitrogen atoms, along with fluorine, which contributes to its unique chemical properties. N-(2-Fluorophenyl)formamide is known for its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. The fluorine atom can influence the compound's reactivity and biological activity, often enhancing lipophilicity and metabolic stability. Additionally, this compound may exhibit polar characteristics due to the formamide group, which can engage in hydrogen bonding. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₆FNO

InChI: InChI=1S/C7H6FNO/c8-6-3-1-2-4-7(6)9-5-10/h1-5H,(H,9,10)

InChI key: InChIKey=FIHZPTWOTZIPHS-UHFFFAOYSA-N

SMILES: N(C=O)C1=C(F)C=CC=C1

Synonyms:

• N-(2-Fluorophenyl)formamide
• Formanilide, 2′-fluoro-
• Formamide, N-(2-fluorophenyl)-