CAS 824-52-2

5-methyl-1H-pyrrolo[2,3-b]pyridine

Description:

5-Methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a methyl group at the 5-position of the pyrrole ring, influencing its reactivity and potential applications. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents, reflecting its aromatic nature. The presence of nitrogen atoms in its structure imparts basicity and potential for coordination with metal ions, making it of interest in coordination chemistry and materials science. Additionally, 5-methyl-1H-pyrrolo[2,3-b]pyridine may exhibit biological activity, which has led to investigations into its pharmacological properties. Its molecular structure allows for various functionalization possibilities, making it a valuable intermediate in organic synthesis. Overall, this compound's unique structural features and reactivity profile make it a subject of interest in both academic research and industrial applications.

Formula: C₈H₈N₂

InChI: InChI=1/C8H8N2/c1-6-4-7-2-3-9-8(7)10-5-6/h2-5H,1H3,(H,9,10)

SMILES: Cc1cc2cc[nH]c2nc1

Synonyms:

• 1H-pyrrolo[2,3-b]pyridine, 5-methyl-
• 5-Methyl-1H-pyrrolo[2,3-b]pyridin
• 5-Methyl-7-Azaindole

5-Methyl-1H-pyrrolo[2,3-b]pyridine

CAS: 824-52-2

Formula: C₈H₈N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 132.1625

Ref: IN-DA003MVT

5-Methyl-1H-pyrrolo[2,3-b]pyridine

CAS: 824-52-2

5-Methyl-1H-pyrrolo[2,3-b]pyridine

Formula: C₈H₈N₂

Purity: 97%

Color and Shape: white to light yellow solid

Molecular weight: 132.16g/mol

Ref: 54-OR964572

5-Methyl-1H-pyrrolo[2,3-b]pyridine

CAS: 824-52-2

Formula: C₈H₈N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 132.166

Ref: 10-F079607