CAS 824-95-3

N-Cyclobutylcyclopentanamine

Description:

N-Cyclobutylcyclopentanamine is an organic compound characterized by its unique bicyclic structure, which consists of a cyclobutane ring attached to a cyclopentane ring, with an amine functional group. This compound is classified as a secondary amine due to the presence of the nitrogen atom bonded to two carbon-containing groups. Its molecular structure contributes to its potential applications in medicinal chemistry and as a building block in organic synthesis. N-Cyclobutylcyclopentanamine is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. It exhibits moderate solubility in organic solvents and may have limited solubility in water. The compound's reactivity is influenced by the amine group, allowing it to participate in various chemical reactions, such as alkylation and acylation. Safety data should be consulted for handling, as amines can be irritants and may pose health risks. Overall, N-Cyclobutylcyclopentanamine is of interest for its structural properties and potential utility in chemical research and development.

Formula: C₉H₁₇N

InChI: InChI=1S/C9H17N/c1-2-5-8(4-1)10-9-6-3-7-9/h8-10H,1-7H2

InChI key: InChIKey=UHUUCQADKIMNQD-UHFFFAOYSA-N

SMILES: N(C1CCC1)C2CCCC2

Synonyms:

• Cyclopentanamine, N-cyclobutyl-
• Cyclopentylamine, N-cyclobutyl-
• N-Cyclobutylcyclopentanamine