CAS 82410-72-8
:N,N-diethyl-2-(2-methyl-1H-imidazol-1-yl)ethanamine
Description:
N,N-Diethyl-2-(2-methyl-1H-imidazol-1-yl)ethanamine, with the CAS number 82410-72-8, is a chemical compound characterized by its unique structure, which includes an imidazole ring and an ethylamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of nitrogen atoms. The imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. It is likely to be soluble in polar solvents, reflecting the presence of both hydrophobic (ethyl groups) and hydrophilic (amine and imidazole) components. The compound may also demonstrate moderate volatility and stability under standard conditions, although specific reactivity can depend on the surrounding environment and functional groups present. Its applications could range from use in pharmaceuticals to research in organic synthesis, although detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C10H19N3
InChI:InChI=1/C10H19N3/c1-4-12(5-2)8-9-13-7-6-11-10(13)3/h6-7H,4-5,8-9H2,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.