CAS 82412-17-7
:(7-methoxy-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid
Description:
(7-Methoxy-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid, with the CAS number 82412-17-7, is a chemical compound belonging to the class of coumarins, which are known for their diverse biological activities. This compound features a coumarin backbone, characterized by a benzopyrone structure, which contributes to its potential pharmacological properties. The presence of a methoxy group and a methyl group on the chromenone ring enhances its lipophilicity, potentially influencing its interaction with biological membranes. The acetic acid moiety adds polar characteristics, which may enhance solubility in aqueous environments. Coumarins are often studied for their anti-inflammatory, antioxidant, and antimicrobial properties, and this specific compound may exhibit similar activities. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its specific biological effects, mechanisms of action, and safety profile would be necessary to fully understand its potential uses in pharmaceuticals or other fields.
Formula:C13H12O5
InChI:InChI=1/C13H12O5/c1-7-9-4-3-8(17-2)5-11(9)18-13(16)10(7)6-12(14)15/h3-5H,6H2,1-2H3,(H,14,15)
SMILES:Cc1c2ccc(cc2oc(=O)c1CC(=O)O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.