CAS 82413-31-8
:1-phenyl-2-(4-tetrahydropyran-2-yloxyphenyl)butan-1-one
Description:
1-Phenyl-2-(4-tetrahydropyran-2-yloxyphenyl)butan-1-one, with the CAS number 82413-31-8, is an organic compound characterized by its complex structure that includes a phenyl group, a tetrahydropyran moiety, and a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in organic solvents. The presence of the tetrahydropyran ring suggests that it may have interesting stereochemical properties and could participate in various chemical reactions, such as nucleophilic substitutions or cyclizations. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could be explored in pharmacological studies. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels.
Formula:C21H24O3
InChI:InChI=1/C21H24O3/c1-2-19(21(22)17-8-4-3-5-9-17)16-11-13-18(14-12-16)24-20-10-6-7-15-23-20/h3-5,8-9,11-14,19-20H,2,6-7,10,15H2,1H3
SMILES:CCC(c1ccc(cc1)OC1CCCCO1)C(=O)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Phenyl-2-[4-[(tetrahydro-2H-pyran-2-yl)oxy]phenyl]-1-butanone
CAS:Controlled ProductApplications An intermediate for the synthesis of Tamoxifen
References Ruenitz, P.C., et al.: J. Med. Chem., 25, 1056 (1982),Formula:C21H24O3Color and Shape:NeatMolecular weight:324.41
