CymitQuimica logo

CAS 82413-57-8

:

Formylaminobutyricacid (alpha-)

Description:
Formylaminobutyric acid (alpha-) is an organic compound characterized by the presence of both an amino group and a formyl group attached to a butyric acid backbone. Its structure features a four-carbon chain with a carboxylic acid group at one end, an amino group at the alpha position, and a formyl group (–CHO) at the terminal position. This compound is typically classified as an amino acid derivative and may exhibit properties such as solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. The presence of both the amino and formyl groups suggests potential reactivity, making it of interest in various chemical synthesis and biological applications. Additionally, its unique structure may influence its behavior in biological systems, potentially affecting its role in metabolic pathways or as a precursor in the synthesis of other compounds. As with many organic compounds, the specific physical and chemical properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which the substance is studied.
Formula:C5H9NO3
InChI:InChI=1/C5H9NO3/c1-2-4(5(8)9)6-3-7/h3-4H,2H2,1H3,(H,6,7)(H,8,9)
SMILES:CCC(C(=O)O)N=CO
Synonyms:
  • N-Formyl-DL-2-amino-n-butyric acid (alpha-)
  • 2-(Formylamino)Butanoic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.