CAS 82413-60-3
:4-[(Dibutylamino)methyl]benzaldehyde
Description:
4-[(Dibutylamino)methyl]benzaldehyde, with the CAS number 82413-60-3, is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group attached to a dibutylamino side chain. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic dibutylamino group. The presence of the dibutylamino moiety imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. This compound may be utilized in the synthesis of other organic molecules, particularly in the development of pharmaceuticals or agrochemicals. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Proper storage in a cool, dry place, away from incompatible substances, is essential to maintain its stability and integrity.
Formula:C16H25NO
InChI:InChI=1S/C16H25NO/c1-3-5-11-17(12-6-4-2)13-15-7-9-16(14-18)10-8-15/h7-10,14H,3-6,11-13H2,1-2H3
InChI key:InChIKey=UCVBRNYVYTYCIK-UHFFFAOYSA-N
SMILES:N(CC1=CC=C(C=O)C=C1)(CCCC)CCCC
Synonyms:- 4-[(Dibutylamino)methyl]benzaldehyde
- Benzaldehyde, 4-[(dibutylamino)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.